C18H24O3 — CID 102292002
[(4aS,8aS)-4-oxo-3-propan-2-ylidene-4a,7,8,8a-tetrahydronaphthalen-2-yl] 2,2-dimethylpropanoate (PubChem CID 102292002) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is [(4aS,8aS)-4-oxo-3-propan-2-ylidene-4a,7,8,8a-tetrahydronaphthalen-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [(4aS,8aS)-4-oxo-3-propan-2-ylidene-4a,7,8,8a-tetrahydronaphthalen-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102292002 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | [(4aS,8aS)-4-oxo-3-propan-2-ylidene-4a,7,8,8a-tetrahydronaphthalen-2-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)=C1C(=O)[C@H]2C=CCC[C@H]2C=C1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C18H24O3/c1-11(2)15-14(21-17(20)18(3,4)5)10-12-8-6-7-9-13(12)16(15)19/h7,9-10,12-13H,6,8H2,1-5H3/t12-,13-/m0/s1 |
| InChIKey | ZJKAEGASPGAFFD-STQMWFEESA-N |
| XLogP | 3.96 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|