About 1,2-benzoxazol-3-one;ethene;methyl (2S)-pyrrolidine-2-carboxylate
1,2-benzoxazol-3-one;ethene;methyl (2S)-pyrrolidine-2-carboxylate (PubChem CID 143275998) has the molecular formula C15H20N2O4
and a molecular weight of 292.34 g/mol. Its IUPAC name is 1,2-benzoxazol-3-one;ethene;methyl (2S)-pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | 1,2-benzoxazol-3-one;ethene;methyl (2S)-pyrrolidine-2-carboxylate |
| PubChem CID | 143275998 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 1,2-benzoxazol-3-one;ethene;methyl (2S)-pyrrolidine-2-carboxylate |
| SMILES | C=C.COC(=O)[C@@H]1CCCN1.O=c1[nH]oc2ccccc12 |
| InChI | InChI=1S/C7H5NO2.C6H11NO2.C2H4/c9-7-5-3-1-2-4-6(5)10-8-7;1-9-6(8)5-3-2-4-7-5;1-2/h1-4H,(H,8,9);5,7H,2-4H2,1H3;1-2H2/t;5-;/m.0./s1 |
| InChIKey | FGVOIOMOKOABFX-NXAOXGSFSA-N |
| XLogP | 1.83 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,2-benzoxazol-3-one;ethene;methyl (2S)-pyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-benzoxazol-3-one;ethene;methyl (2S)-pyrrolidine-2-carboxylate?
The IUPAC name of 1,2-benzoxazol-3-one;ethene;methyl (2S)-pyrrolidine-2-carboxylate (CID 143275998) is 1,2-benzoxazol-3-one;ethene;methyl (2S)-pyrrolidine-2-carboxylate.
What is the SMILES notation for 1,2-benzoxazol-3-one;ethene;methyl (2S)-pyrrolidine-2-carboxylate?
The canonical SMILES for 1,2-benzoxazol-3-one;ethene;methyl (2S)-pyrrolidine-2-carboxylate is C=C.COC(=O)[C@@H]1CCCN1.O=c1[nH]oc2ccccc12.
What is the InChIKey of 1,2-benzoxazol-3-one;ethene;methyl (2S)-pyrrolidine-2-carboxylate?
The InChIKey is FGVOIOMOKOABFX-NXAOXGSFSA-N. The full InChI is InChI=1S/C7H5NO2.C6H11NO2.C2H4/c9-7-5-3-1-2-4-6(5)10-8-7;1-9-6(8)5-3-2-4-7-5;1-2/h1-4H,(H,8,9);5,7H,2-4H2,1H3;1-2H2/t;5-;/m.0./s1.
What are the key properties of 1,2-benzoxazol-3-one;ethene;methyl (2S)-pyrrolidine-2-carboxylate?
1,2-benzoxazol-3-one;ethene;methyl (2S)-pyrrolidine-2-carboxylate has a molecular weight of 292.34 g/mol, XLogP of 1.83, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-benzoxazol-3-one;ethene;methyl (2S)-pyrrolidine-2-carboxylate is sourced from PubChem (CID 143275998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).