C18H18N2O3 — CID 68603513
N-(2-methoxydibenzofuran-3-yl)pyrrolidine-2-carboxamide (PubChem CID 68603513) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is N-(2-methoxydibenzofuran-3-yl)pyrrolidine-2-carboxamide.
| Compound Name | N-(2-methoxydibenzofuran-3-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 68603513 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | N-(2-methoxydibenzofuran-3-yl)pyrrolidine-2-carboxamide |
| SMILES | COc1cc2c(cc1NC(=O)C1CCCN1)oc1ccccc12 |
| InChI | InChI=1S/C18H18N2O3/c1-22-17-9-12-11-5-2-3-7-15(11)23-16(12)10-14(17)20-18(21)13-6-4-8-19-13/h2-3,5,7,9-10,13,19H,4,6,8H2,1H3,(H,20,21) |
| InChIKey | DHXPDDNEWFPYQB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |