C26H35NO6 — CID 143276396
(E)-5,5-dihydroxy-7-[4-(4-hydroxyphenyl)-5-(methoxymethyl)-2,6-di(propan-2-yl)-3-pyridinyl]hept-6-enoic acid (PubChem CID 143276396) has the molecular formula C26H35NO6 and a molecular weight of 457.57 g/mol. Its IUPAC name is (E)-5,5-dihydroxy-7-[4-(4-hydroxyphenyl)-5-(methoxymethyl)-2,6-di(propan-2-yl)-3-pyridinyl]hept-6-enoic acid.
| Compound Name | (E)-5,5-dihydroxy-7-[4-(4-hydroxyphenyl)-5-(methoxymethyl)-2,6-di(propan-2-yl)-3-pyridinyl]hept-6-enoic acid |
|---|---|
| PubChem CID | 143276396 |
| Molecular Formula | C26H35NO6 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | (E)-5,5-dihydroxy-7-[4-(4-hydroxyphenyl)-5-(methoxymethyl)-2,6-di(propan-2-yl)-3-pyridinyl]hept-6-enoic acid |
| SMILES | COCc1c(C(C)C)nc(C(C)C)c(/C=C/C(O)(O)CCCC(=O)O)c1-c1ccc(O)cc1 |
| InChI | InChI=1S/C26H35NO6/c1-16(2)24-20(12-14-26(31,32)13-6-7-22(29)30)23(18-8-10-19(28)11-9-18)21(15-33-5)25(27-24)17(3)4/h8-12,14,16-17,28,31-32H,6-7,13,15H2,1-5H3,(H,29,30)/b14-12+ |
| InChIKey | NOTRERCWLYMWTH-WYMLVPIESA-N |
| XLogP | 4.80 |
| TPSA | 120.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|