C10H17F2N — CID 143279772
(2E,4E)-2-ethyl-5,6-difluoro-N-methylhepta-2,4-dien-1-amine (PubChem CID 143279772) has the molecular formula C10H17F2N and a molecular weight of 189.25 g/mol. Its IUPAC name is (2E,4E)-2-ethyl-5,6-difluoro-N-methylhepta-2,4-dien-1-amine.
| Compound Name | (2E,4E)-2-ethyl-5,6-difluoro-N-methylhepta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 143279772 |
| Molecular Formula | C10H17F2N |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | (2E,4E)-2-ethyl-5,6-difluoro-N-methylhepta-2,4-dien-1-amine |
| SMILES | CC/C(=C\C=C(\F)C(C)F)CNC |
| InChI | InChI=1S/C10H17F2N/c1-4-9(7-13-3)5-6-10(12)8(2)11/h5-6,8,13H,4,7H2,1-3H3/b9-5+,10-6+ |
| InChIKey | VWGSOLAYGXQYDB-NXZHAISVSA-N |
| XLogP | 2.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|