C20H36ClN5 — CID 143280099
(1Z,3E,5E)-5-chloro-4-[3-ethyl-4-(1-ethylpiperidin-4-yl)piperazin-1-yl]hepta-1,3,5-triene-1,2-diamine (PubChem CID 143280099) has the molecular formula C20H36ClN5 and a molecular weight of 382.00 g/mol. Its IUPAC name is (1Z,3E,5E)-5-chloro-4-[3-ethyl-4-(1-ethylpiperidin-4-yl)piperazin-1-yl]hepta-1,3,5-triene-1,2-diamine.
| Compound Name | (1Z,3E,5E)-5-chloro-4-[3-ethyl-4-(1-ethylpiperidin-4-yl)piperazin-1-yl]hepta-1,3,5-triene-1,2-diamine |
|---|---|
| PubChem CID | 143280099 |
| Molecular Formula | C20H36ClN5 |
| Molecular Weight | 382.00 g/mol |
| Exact Mass | 381.27 |
| IUPAC Name | (1Z,3E,5E)-5-chloro-4-[3-ethyl-4-(1-ethylpiperidin-4-yl)piperazin-1-yl]hepta-1,3,5-triene-1,2-diamine |
| SMILES | C/C=C(Cl)\C(=C/C(N)=C/N)N1CCN(C2CCN(CC)CC2)C(CC)C1 |
| InChI | InChI=1S/C20H36ClN5/c1-4-17-15-25(20(19(21)5-2)13-16(23)14-22)11-12-26(17)18-7-9-24(6-3)10-8-18/h5,13-14,17-18H,4,6-12,15,22-23H2,1-3H3/b16-14-,19-5+,20-13+ |
| InChIKey | WGDVJSBGVIWICG-CPOMCMMESA-N |
| XLogP | 2.65 |
| TPSA | 61.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.00 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|