C11H18ClN3 — CID 139373625
5-chloro-1-(1-methylpiperidin-4-yl)-2H-pyridin-3-amine (PubChem CID 139373625) has the molecular formula C11H18ClN3 and a molecular weight of 227.74 g/mol. Its IUPAC name is 5-chloro-1-(1-methylpiperidin-4-yl)-2H-pyridin-3-amine.
| Compound Name | 5-chloro-1-(1-methylpiperidin-4-yl)-2H-pyridin-3-amine |
|---|---|
| PubChem CID | 139373625 |
| Molecular Formula | C11H18ClN3 |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 5-chloro-1-(1-methylpiperidin-4-yl)-2H-pyridin-3-amine |
| SMILES | CN1CCC(N2C=C(Cl)C=C(N)C2)CC1 |
| InChI | InChI=1S/C11H18ClN3/c1-14-4-2-11(3-5-14)15-7-9(12)6-10(13)8-15/h6-7,11H,2-5,8,13H2,1H3 |
| InChIKey | ZVSVGDBIUIXANA-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |