C14H24ClN3 — CID 145119236
(3Z)-3-chloro-2-N,2-N-dimethyl-4-N-(1-methylpiperidin-3-yl)hexa-1,3,5-triene-2,4-diamine (PubChem CID 145119236) has the molecular formula C14H24ClN3 and a molecular weight of 269.82 g/mol. Its IUPAC name is (3Z)-3-chloro-2-N,2-N-dimethyl-4-N-(1-methylpiperidin-3-yl)hexa-1,3,5-triene-2,4-diamine.
| Compound Name | (3Z)-3-chloro-2-N,2-N-dimethyl-4-N-(1-methylpiperidin-3-yl)hexa-1,3,5-triene-2,4-diamine |
|---|---|
| PubChem CID | 145119236 |
| Molecular Formula | C14H24ClN3 |
| Molecular Weight | 269.82 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | (3Z)-3-chloro-2-N,2-N-dimethyl-4-N-(1-methylpiperidin-3-yl)hexa-1,3,5-triene-2,4-diamine |
| SMILES | C=C/C(NC1CCCN(C)C1)=C(/Cl)C(=C)N(C)C |
| InChI | InChI=1S/C14H24ClN3/c1-6-13(14(15)11(2)17(3)4)16-12-8-7-9-18(5)10-12/h6,12,16H,1-2,7-10H2,3-5H3/b14-13- |
| InChIKey | XPYHXUMBXQHWSL-YPKPFQOOSA-N |
| XLogP | 2.38 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.82 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|