C14H26N2 — CID 143501788
ethane;N-[(3E)-hexa-1,3,5-trien-3-yl]-1-methylpiperidin-4-amine (PubChem CID 143501788) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is ethane;N-[(3E)-hexa-1,3,5-trien-3-yl]-1-methylpiperidin-4-amine.
| Compound Name | ethane;N-[(3E)-hexa-1,3,5-trien-3-yl]-1-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 143501788 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | ethane;N-[(3E)-hexa-1,3,5-trien-3-yl]-1-methylpiperidin-4-amine |
| SMILES | C=C/C=C(\C=C)NC1CCN(C)CC1.CC |
| InChI | InChI=1S/C12H20N2.C2H6/c1-4-6-11(5-2)13-12-7-9-14(3)10-8-12;1-2/h4-6,12-13H,1-2,7-10H2,3H3;1-2H3/b11-6+; |
| InChIKey | VWYPGPQYPRGCGQ-ICSBZGNSSA-N |
| XLogP | 2.95 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|