C11H19N3 — CID 139401863
1-(1-methylpiperidin-4-yl)-2H-pyridin-3-amine (PubChem CID 139401863) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 1-(1-methylpiperidin-4-yl)-2H-pyridin-3-amine.
| Compound Name | 1-(1-methylpiperidin-4-yl)-2H-pyridin-3-amine |
|---|---|
| PubChem CID | 139401863 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 1-(1-methylpiperidin-4-yl)-2H-pyridin-3-amine |
| SMILES | CN1CCC(N2C=CC=C(N)C2)CC1 |
| InChI | InChI=1S/C11H19N3/c1-13-7-4-11(5-8-13)14-6-2-3-10(12)9-14/h2-3,6,11H,4-5,7-9,12H2,1H3 |
| InChIKey | FNOWYWGAYFTVKX-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |