C29H49ClFN5 — CID 143280098
(1Z,3E,5E)-5-chloro-4-[3-ethyl-4-(1-ethylpiperidin-4-yl)piperazin-1-yl]hepta-1,3,5-triene-1,2-diamine;(3E)-4-fluoro-3,6-dimethylhepta-1,3,5-triene (PubChem CID 143280098) has the molecular formula C29H49ClFN5 and a molecular weight of 522.20 g/mol. Its IUPAC name is (1Z,3E,5E)-5-chloro-4-[3-ethyl-4-(1-ethylpiperidin-4-yl)piperazin-1-yl]hepta-1,3,5-triene-1,2-diamine;(3E)-4-fluoro-3,6-dimethylhepta-1,3,5-triene.
| Compound Name | (1Z,3E,5E)-5-chloro-4-[3-ethyl-4-(1-ethylpiperidin-4-yl)piperazin-1-yl]hepta-1,3,5-triene-1,2-diamine;(3E)-4-fluoro-3,6-dimethylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 143280098 |
| Molecular Formula | C29H49ClFN5 |
| Molecular Weight | 522.20 g/mol |
| Exact Mass | 521.37 |
| IUPAC Name | (1Z,3E,5E)-5-chloro-4-[3-ethyl-4-(1-ethylpiperidin-4-yl)piperazin-1-yl]hepta-1,3,5-triene-1,2-diamine;(3E)-4-fluoro-3,6-dimethylhepta-1,3,5-triene |
| SMILES | C/C=C(Cl)\C(=C/C(N)=C/N)N1CCN(C2CCN(CC)CC2)C(CC)C1.C=C/C(C)=C(/F)C=C(C)C |
| InChI | InChI=1S/C20H36ClN5.C9H13F/c1-4-17-15-25(20(19(21)5-2)13-16(23)14-22)11-12-26(17)18-7-9-24(6-3)10-8-18;1-5-8(4)9(10)6-7(2)3/h5,13-14,17-18H,4,6-12,15,22-23H2,1-3H3;5-6H,1H2,2-4H3/b16-14-,19-5+,20-13+;9-8+ |
| InChIKey | ZRWJEROVTILRNJ-DJQFBQHNSA-N |
| XLogP | 6.03 |
| TPSA | 61.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.20 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|