C29H46Cl2FN5 — CID 143280113
(1E,3E)-4-chloro-5-[4-[1-[(2Z,3Z,5E)-5-chloro-2-(1-fluoroethylidene)-3-methylhepta-3,5-dienyl]piperidin-4-yl]-3-ethylpiperazin-1-yl]-2-N-ethenyl-2-N-methylpenta-1,3-diene-1,2-diamine (PubChem CID 143280113) has the molecular formula C29H46Cl2FN5 and a molecular weight of 554.63 g/mol. Its IUPAC name is (1E,3E)-4-chloro-5-[4-[1-[(2Z,3Z,5E)-5-chloro-2-(1-fluoroethylidene)-3-methylhepta-3,5-dienyl]piperidin-4-yl]-3-ethylpiperazin-1-yl]-2-N-ethenyl-2-N-methylpenta-1,3-diene-1,2-diamine.
| Compound Name | (1E,3E)-4-chloro-5-[4-[1-[(2Z,3Z,5E)-5-chloro-2-(1-fluoroethylidene)-3-methylhepta-3,5-dienyl]piperidin-4-yl]-3-ethylpiperazin-1-yl]-2-N-ethenyl-2-N-methylpenta-1,3-diene-1,2-diamine |
|---|---|
| PubChem CID | 143280113 |
| Molecular Formula | C29H46Cl2FN5 |
| Molecular Weight | 554.63 g/mol |
| Exact Mass | 553.31 |
| IUPAC Name | (1E,3E)-4-chloro-5-[4-[1-[(2Z,3Z,5E)-5-chloro-2-(1-fluoroethylidene)-3-methylhepta-3,5-dienyl]piperidin-4-yl]-3-ethylpiperazin-1-yl]-2-N-ethenyl-2-N-methylpenta-1,3-diene-1,2-diamine |
| SMILES | C=CN(C)C(/C=C(/Cl)CN1CCN(C2CCN(CC(/C(C)=C\C(Cl)=C/C)=C(/C)F)CC2)C(CC)C1)=C/N |
| InChI | InChI=1S/C29H46Cl2FN5/c1-7-24(30)16-22(4)29(23(5)32)21-35-12-10-27(11-13-35)37-15-14-36(20-26(37)8-2)19-25(31)17-28(18-33)34(6)9-3/h7,9,16-18,26-27H,3,8,10-15,19-21,33H2,1-2,4-6H3/b22-16-,24-7+,25-17+,28-18+,29-23+ |
| InChIKey | WKGKCHGFDXBDQH-XWQXLKQASA-N |
| XLogP | 6.18 |
| TPSA | 38.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.63 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|