C23H36N2O4 — CID 143282640
2-(1-methylazepan-4-yl)ethyl (1E)-N-[3-(4-hydroxycyclohexyl)oxyphenoxy]ethanimidate (PubChem CID 143282640) has the molecular formula C23H36N2O4 and a molecular weight of 404.55 g/mol. Its IUPAC name is 2-(1-methylazepan-4-yl)ethyl (1E)-N-[3-(4-hydroxycyclohexyl)oxyphenoxy]ethanimidate.
| Compound Name | 2-(1-methylazepan-4-yl)ethyl (1E)-N-[3-(4-hydroxycyclohexyl)oxyphenoxy]ethanimidate |
|---|---|
| PubChem CID | 143282640 |
| Molecular Formula | C23H36N2O4 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | 2-(1-methylazepan-4-yl)ethyl (1E)-N-[3-(4-hydroxycyclohexyl)oxyphenoxy]ethanimidate |
| SMILES | C/C(=N\Oc1cccc(OC2CCC(O)CC2)c1)OCCC1CCCN(C)CC1 |
| InChI | InChI=1S/C23H36N2O4/c1-18(27-16-13-19-5-4-14-25(2)15-12-19)24-29-23-7-3-6-22(17-23)28-21-10-8-20(26)9-11-21/h3,6-7,17,19-21,26H,4-5,8-16H2,1-2H3/b24-18+ |
| InChIKey | OIXUCOGYQRGPGF-HKOYGPOVSA-N |
| XLogP | 4.22 |
| TPSA | 63.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|