C18H22O — CID 143282659
2-ethyl-6-methylbenzaldehyde;1,4-xylene (PubChem CID 143282659) has the molecular formula C18H22O and a molecular weight of 254.37 g/mol. Its IUPAC name is 2-ethyl-6-methylbenzaldehyde;1,4-xylene.
| Compound Name | 2-ethyl-6-methylbenzaldehyde;1,4-xylene |
|---|---|
| PubChem CID | 143282659 |
| Molecular Formula | C18H22O |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 2-ethyl-6-methylbenzaldehyde;1,4-xylene |
| SMILES | CCc1cccc(C)c1C=O.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C10H12O.C8H10/c1-3-9-6-4-5-8(2)10(9)7-11;1-7-3-5-8(2)6-4-7/h4-7H,3H2,1-2H3;3-6H,1-2H3 |
| InChIKey | YNEHYLKAEMGFLK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|