C35H46FN3O2 — CID 143285955
propan-2-yl 7-[1-[2-[6-fluoro-3-[(1-methylpyrrolidin-2-yl)methyl]indol-1-yl]ethyl]indol-3-yl]-6-methylheptanoate (PubChem CID 143285955) has the molecular formula C35H46FN3O2 and a molecular weight of 559.77 g/mol. Its IUPAC name is propan-2-yl 7-[1-[2-[6-fluoro-3-[(1-methylpyrrolidin-2-yl)methyl]indol-1-yl]ethyl]indol-3-yl]-6-methylheptanoate.
| Compound Name | propan-2-yl 7-[1-[2-[6-fluoro-3-[(1-methylpyrrolidin-2-yl)methyl]indol-1-yl]ethyl]indol-3-yl]-6-methylheptanoate |
|---|---|
| PubChem CID | 143285955 |
| Molecular Formula | C35H46FN3O2 |
| Molecular Weight | 559.77 g/mol |
| Exact Mass | 559.36 |
| IUPAC Name | propan-2-yl 7-[1-[2-[6-fluoro-3-[(1-methylpyrrolidin-2-yl)methyl]indol-1-yl]ethyl]indol-3-yl]-6-methylheptanoate |
| SMILES | CC(CCCCC(=O)OC(C)C)Cc1cn(CCn2cc(CC3CCCN3C)c3ccc(F)cc32)c2ccccc12 |
| InChI | InChI=1S/C35H46FN3O2/c1-25(2)41-35(40)14-8-5-10-26(3)20-27-23-38(33-13-7-6-12-31(27)33)18-19-39-24-28(21-30-11-9-17-37(30)4)32-16-15-29(36)22-34(32)39/h6-7,12-13,15-16,22-26,30H,5,8-11,14,17-21H2,1-4H3 |
| InChIKey | BPJWTDJQNGKZBG-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 39.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.77 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|