C39H32 — CID 143286377
1-ethenyl-4-[(E)-2-[4-[4-[(1Z)-3-methyl-2-phenylbuta-1,3-dienyl]phenyl]phenyl]-1-phenylethenyl]benzene (PubChem CID 143286377) has the molecular formula C39H32 and a molecular weight of 500.69 g/mol. Its IUPAC name is 1-ethenyl-4-[(E)-2-[4-[4-[(1Z)-3-methyl-2-phenylbuta-1,3-dienyl]phenyl]phenyl]-1-phenylethenyl]benzene.
| Compound Name | 1-ethenyl-4-[(E)-2-[4-[4-[(1Z)-3-methyl-2-phenylbuta-1,3-dienyl]phenyl]phenyl]-1-phenylethenyl]benzene |
|---|---|
| PubChem CID | 143286377 |
| Molecular Formula | C39H32 |
| Molecular Weight | 500.69 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | 1-ethenyl-4-[(E)-2-[4-[4-[(1Z)-3-methyl-2-phenylbuta-1,3-dienyl]phenyl]phenyl]-1-phenylethenyl]benzene |
| SMILES | C=Cc1ccc(/C(=C/c2ccc(-c3ccc(/C=C(/C(=C)C)c4ccccc4)cc3)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C39H32/c1-4-30-15-25-37(26-16-30)39(36-13-9-6-10-14-36)28-32-19-23-34(24-20-32)33-21-17-31(18-22-33)27-38(29(2)3)35-11-7-5-8-12-35/h4-28H,1-2H2,3H3/b38-27-,39-28+ |
| InChIKey | GGRQLZXRCAUSFY-WITPOYJRSA-N |
| XLogP | 10.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.69 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|