C8H10N4O2S — CID 143286476
1-amino-3-[(E)-(2,4-dihydroxyphenyl)methylideneamino]thiourea (PubChem CID 143286476) has the molecular formula C8H10N4O2S and a molecular weight of 226.26 g/mol. Its IUPAC name is 1-amino-3-[(E)-(2,4-dihydroxyphenyl)methylideneamino]thiourea.
| Compound Name | 1-amino-3-[(E)-(2,4-dihydroxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 143286476 |
| Molecular Formula | C8H10N4O2S |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 1-amino-3-[(E)-(2,4-dihydroxyphenyl)methylideneamino]thiourea |
| SMILES | NNC(=S)N/N=C/c1ccc(O)cc1O |
| InChI | InChI=1S/C8H10N4O2S/c9-11-8(15)12-10-4-5-1-2-6(13)3-7(5)14/h1-4,13-14H,9H2,(H2,11,12,15)/b10-4+ |
| InChIKey | WGHMTJGWILSNNF-ONNFQVAWSA-N |
| XLogP | -0.23 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|