C17H17F2NO4S — CID 143287620
2-amino-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid;4-(difluoromethoxy)benzaldehyde (PubChem CID 143287620) has the molecular formula C17H17F2NO4S and a molecular weight of 369.39 g/mol. Its IUPAC name is 2-amino-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid;4-(difluoromethoxy)benzaldehyde.
| Compound Name | 2-amino-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid;4-(difluoromethoxy)benzaldehyde |
|---|---|
| PubChem CID | 143287620 |
| Molecular Formula | C17H17F2NO4S |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 2-amino-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid;4-(difluoromethoxy)benzaldehyde |
| SMILES | Nc1sc2c(c1C(=O)O)CCCC2.O=Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C9H11NO2S.C8H6F2O2/c10-8-7(9(11)12)5-3-1-2-4-6(5)13-8;9-8(10)12-7-3-1-6(5-11)2-4-7/h1-4,10H2,(H,11,12);1-5,8H |
| InChIKey | REBJWSGYXWYHMS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|