About 2-[4-(aminomethyl)phenoxy]acetic acid;ethane;piperidine-4-carboxylic acid
2-[4-(aminomethyl)phenoxy]acetic acid;ethane;piperidine-4-carboxylic acid (PubChem CID 143289361) has the molecular formula C17H28N2O5
and a molecular weight of 340.42 g/mol. Its IUPAC name is 2-[4-(aminomethyl)phenoxy]acetic acid;ethane;piperidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-[4-(aminomethyl)phenoxy]acetic acid;ethane;piperidine-4-carboxylic acid |
| PubChem CID | 143289361 |
| Molecular Formula | C17H28N2O5 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 2-[4-(aminomethyl)phenoxy]acetic acid;ethane;piperidine-4-carboxylic acid |
| SMILES | CC.NCc1ccc(OCC(=O)O)cc1.O=C(O)C1CCNCC1 |
| InChI | InChI=1S/C9H11NO3.C6H11NO2.C2H6/c10-5-7-1-3-8(4-2-7)13-6-9(11)12;8-6(9)5-1-3-7-4-2-5;1-2/h1-4H,5-6,10H2,(H,11,12);5,7H,1-4H2,(H,8,9);1-2H3 |
| InChIKey | ONGLKJNDVABBIU-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(aminomethyl)phenoxy]acetic acid;ethane;piperidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(aminomethyl)phenoxy]acetic acid;ethane;piperidine-4-carboxylic acid?
The IUPAC name of 2-[4-(aminomethyl)phenoxy]acetic acid;ethane;piperidine-4-carboxylic acid (CID 143289361) is 2-[4-(aminomethyl)phenoxy]acetic acid;ethane;piperidine-4-carboxylic acid.
What is the SMILES notation for 2-[4-(aminomethyl)phenoxy]acetic acid;ethane;piperidine-4-carboxylic acid?
The canonical SMILES for 2-[4-(aminomethyl)phenoxy]acetic acid;ethane;piperidine-4-carboxylic acid is CC.NCc1ccc(OCC(=O)O)cc1.O=C(O)C1CCNCC1.
What is the InChIKey of 2-[4-(aminomethyl)phenoxy]acetic acid;ethane;piperidine-4-carboxylic acid?
The InChIKey is ONGLKJNDVABBIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO3.C6H11NO2.C2H6/c10-5-7-1-3-8(4-2-7)13-6-9(11)12;8-6(9)5-1-3-7-4-2-5;1-2/h1-4H,5-6,10H2,(H,11,12);5,7H,1-4H2,(H,8,9);1-2H3.
What are the key properties of 2-[4-(aminomethyl)phenoxy]acetic acid;ethane;piperidine-4-carboxylic acid?
2-[4-(aminomethyl)phenoxy]acetic acid;ethane;piperidine-4-carboxylic acid has a molecular weight of 340.42 g/mol, XLogP of 1.71, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(aminomethyl)phenoxy]acetic acid;ethane;piperidine-4-carboxylic acid is sourced from PubChem (CID 143289361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).