C19H29N3O3 — CID 67597157
2-[4-[4-[amino(piperidin-4-yl)methyl]piperidin-1-yl]phenoxy]acetic acid (PubChem CID 67597157) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is 2-[4-[4-[amino(piperidin-4-yl)methyl]piperidin-1-yl]phenoxy]acetic acid.
| Compound Name | 2-[4-[4-[amino(piperidin-4-yl)methyl]piperidin-1-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 67597157 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | 2-[4-[4-[amino(piperidin-4-yl)methyl]piperidin-1-yl]phenoxy]acetic acid |
| SMILES | NC(C1CCNCC1)C1CCN(c2ccc(OCC(=O)O)cc2)CC1 |
| InChI | InChI=1S/C19H29N3O3/c20-19(14-5-9-21-10-6-14)15-7-11-22(12-8-15)16-1-3-17(4-2-16)25-13-18(23)24/h1-4,14-15,19,21H,5-13,20H2,(H,23,24) |
| InChIKey | YLQUREQLJGREAR-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|