C21H36Cl2N3O3+ — CID 70076370
[1-[4-(2-methoxy-2-oxoethoxy)phenyl]piperidin-4-yl]-dimethyl-piperidin-4-ylazanium;dihydrochloride (PubChem CID 70076370) has the molecular formula C21H36Cl2N3O3+ and a molecular weight of 449.44 g/mol. Its IUPAC name is [1-[4-(2-methoxy-2-oxoethoxy)phenyl]piperidin-4-yl]-dimethyl-piperidin-4-ylazanium;dihydrochloride.
| Compound Name | [1-[4-(2-methoxy-2-oxoethoxy)phenyl]piperidin-4-yl]-dimethyl-piperidin-4-ylazanium;dihydrochloride |
|---|---|
| PubChem CID | 70076370 |
| Molecular Formula | C21H36Cl2N3O3+ |
| Molecular Weight | 449.44 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | [1-[4-(2-methoxy-2-oxoethoxy)phenyl]piperidin-4-yl]-dimethyl-piperidin-4-ylazanium;dihydrochloride |
| SMILES | COC(=O)COc1ccc(N2CCC([N+](C)(C)C3CCNCC3)CC2)cc1.Cl.Cl |
| InChI | InChI=1S/C21H34N3O3.2ClH/c1-24(2,18-8-12-22-13-9-18)19-10-14-23(15-11-19)17-4-6-20(7-5-17)27-16-21(25)26-3;;/h4-7,18-19,22H,8-16H2,1-3H3;2*1H/q+1;; |
| InChIKey | IFTLKQCDTUQDDB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|