C17H16 — CID 143289408
8,9-dimethyltricyclo[8.4.1.02,7]pentadeca-2,4,6,8,10(15),11,13-heptaene (PubChem CID 143289408) has the molecular formula C17H16 and a molecular weight of 220.31 g/mol. Its IUPAC name is 8,9-dimethyltricyclo[8.4.1.02,7]pentadeca-2,4,6,8,10(15),11,13-heptaene.
| Compound Name | 8,9-dimethyltricyclo[8.4.1.02,7]pentadeca-2,4,6,8,10(15),11,13-heptaene |
|---|---|
| PubChem CID | 143289408 |
| Molecular Formula | C17H16 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 8,9-dimethyltricyclo[8.4.1.02,7]pentadeca-2,4,6,8,10(15),11,13-heptaene |
| SMILES | CC1=C(C)c2ccccc2C2C=CC=CC1=C2 |
| InChI | InChI=1S/C17H16/c1-12-13(2)16-9-5-6-10-17(16)15-8-4-3-7-14(12)11-15/h3-11,15H,1-2H3 |
| InChIKey | SSTWZRZPGUXSPW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |