C28H36N4O6 — CID 143289792
1-[4-(morpholine-4-carbonyl)cyclohexa-1,3-dien-1-yl]-3-[[5-propan-2-yl-2,4-bis(prop-2-enoxy)benzoyl]amino]urea (PubChem CID 143289792) has the molecular formula C28H36N4O6 and a molecular weight of 524.62 g/mol. Its IUPAC name is 1-[4-(morpholine-4-carbonyl)cyclohexa-1,3-dien-1-yl]-3-[[5-propan-2-yl-2,4-bis(prop-2-enoxy)benzoyl]amino]urea.
| Compound Name | 1-[4-(morpholine-4-carbonyl)cyclohexa-1,3-dien-1-yl]-3-[[5-propan-2-yl-2,4-bis(prop-2-enoxy)benzoyl]amino]urea |
|---|---|
| PubChem CID | 143289792 |
| Molecular Formula | C28H36N4O6 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | 1-[4-(morpholine-4-carbonyl)cyclohexa-1,3-dien-1-yl]-3-[[5-propan-2-yl-2,4-bis(prop-2-enoxy)benzoyl]amino]urea |
| SMILES | C=CCOc1cc(OCC=C)c(C(C)C)cc1C(=O)NNC(=O)NC1=CC=C(C(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C28H36N4O6/c1-5-13-37-24-18-25(38-14-6-2)23(17-22(24)19(3)4)26(33)30-31-28(35)29-21-9-7-20(8-10-21)27(34)32-11-15-36-16-12-32/h5-7,9,17-19H,1-2,8,10-16H2,3-4H3,(H,30,33)(H2,29,31,35) |
| InChIKey | QLTZRUNODPAMTA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|