C29H34N4O4S — CID 89226376
1-[[5-but-2-ynyl-2,4-bis(prop-2-enoxy)benzoyl]amino]-3-[4-(morpholin-4-ylmethyl)phenyl]thiourea (PubChem CID 89226376) has the molecular formula C29H34N4O4S and a molecular weight of 534.68 g/mol. Its IUPAC name is 1-[[5-but-2-ynyl-2,4-bis(prop-2-enoxy)benzoyl]amino]-3-[4-(morpholin-4-ylmethyl)phenyl]thiourea.
| Compound Name | 1-[[5-but-2-ynyl-2,4-bis(prop-2-enoxy)benzoyl]amino]-3-[4-(morpholin-4-ylmethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 89226376 |
| Molecular Formula | C29H34N4O4S |
| Molecular Weight | 534.68 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | 1-[[5-but-2-ynyl-2,4-bis(prop-2-enoxy)benzoyl]amino]-3-[4-(morpholin-4-ylmethyl)phenyl]thiourea |
| SMILES | C=CCOc1cc(OCC=C)c(C(=O)NNC(=S)Nc2ccc(CN3CCOCC3)cc2)cc1CC#CC |
| InChI | InChI=1S/C29H34N4O4S/c1-4-7-8-23-19-25(27(37-16-6-3)20-26(23)36-15-5-2)28(34)31-32-29(38)30-24-11-9-22(10-12-24)21-33-13-17-35-18-14-33/h5-6,9-12,19-20H,2-3,8,13-18,21H2,1H3,(H,31,34)(H2,30,32,38) |
| InChIKey | XCJUKNOMUJXTEK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 84.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.68 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|