C11H14O5 — CID 143290009
(2E,3E,5Z)-3-(carboxymethoxy)-2-ethylidenehepta-3,5-dienoic acid (PubChem CID 143290009) has the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. Its IUPAC name is (2E,3E,5Z)-3-(carboxymethoxy)-2-ethylidenehepta-3,5-dienoic acid.
| Compound Name | (2E,3E,5Z)-3-(carboxymethoxy)-2-ethylidenehepta-3,5-dienoic acid |
|---|---|
| PubChem CID | 143290009 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | (2E,3E,5Z)-3-(carboxymethoxy)-2-ethylidenehepta-3,5-dienoic acid |
| SMILES | C/C=C\C=C(OCC(=O)O)/C(=C\C)C(=O)O |
| InChI | InChI=1S/C11H14O5/c1-3-5-6-9(16-7-10(12)13)8(4-2)11(14)15/h3-6H,7H2,1-2H3,(H,12,13)(H,14,15)/b5-3-,8-4+,9-6+ |
| InChIKey | HSJYFEPKGPTPTL-TYKJNVJLSA-N |
| XLogP | 1.58 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|