C11H17N — CID 143290447
1-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-azabicyclo[3.1.0]hexane (PubChem CID 143290447) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is 1-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-azabicyclo[3.1.0]hexane.
| Compound Name | 1-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 143290447 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 1-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-azabicyclo[3.1.0]hexane |
| SMILES | C/C=C\C(=C/C)C12CNCC1C2 |
| InChI | InChI=1S/C11H17N/c1-3-5-9(4-2)11-6-10(11)7-12-8-11/h3-5,10,12H,6-8H2,1-2H3/b5-3-,9-4+ |
| InChIKey | QOOQSHCSBYMFSE-LWUTYWFWSA-N |
| XLogP | 2.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|