C13H15ClF3N — CID 135292670
(1S,5R)-1-[(3Z,5Z)-5-chloro-7,7,7-trifluoro-6-methylhepta-1,3,5-trien-2-yl]-3-azabicyclo[3.1.0]hexane (PubChem CID 135292670) has the molecular formula C13H15ClF3N and a molecular weight of 277.72 g/mol. Its IUPAC name is (1S,5R)-1-[(3Z,5Z)-5-chloro-7,7,7-trifluoro-6-methylhepta-1,3,5-trien-2-yl]-3-azabicyclo[3.1.0]hexane.
| Compound Name | (1S,5R)-1-[(3Z,5Z)-5-chloro-7,7,7-trifluoro-6-methylhepta-1,3,5-trien-2-yl]-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 135292670 |
| Molecular Formula | C13H15ClF3N |
| Molecular Weight | 277.72 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | (1S,5R)-1-[(3Z,5Z)-5-chloro-7,7,7-trifluoro-6-methylhepta-1,3,5-trien-2-yl]-3-azabicyclo[3.1.0]hexane |
| SMILES | C=C(/C=C\C(Cl)=C(/C)C(F)(F)F)[C@@]12CNC[C@@H]1C2 |
| InChI | InChI=1S/C13H15ClF3N/c1-8(12-5-10(12)6-18-7-12)3-4-11(14)9(2)13(15,16)17/h3-4,10,18H,1,5-7H2,2H3/b4-3-,11-9-/t10-,12+/m0/s1 |
| InChIKey | QUYHWOHJTVOILH-IHLLDROCSA-N |
| XLogP | 3.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.72 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|