C12H17N — CID 143290484
1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-azabicyclo[3.1.0]hexane (PubChem CID 143290484) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-azabicyclo[3.1.0]hexane.
| Compound Name | 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 143290484 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-azabicyclo[3.1.0]hexane |
| SMILES | C=C/C=C(\C=C/C)C12CNCC1C2 |
| InChI | InChI=1S/C12H17N/c1-3-5-10(6-4-2)12-7-11(12)8-13-9-12/h3-6,11,13H,1,7-9H2,2H3/b6-4-,10-5+ |
| InChIKey | KUORZHLVTCLZSM-KNVSICBPSA-N |
| XLogP | 2.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|