C17H33N — CID 143290460
ethane;(4E)-N,N,2,3,3-pentamethyl-4-[(Z)-prop-1-enyl]hepta-4,6-dien-1-amine (PubChem CID 143290460) has the molecular formula C17H33N and a molecular weight of 251.46 g/mol. Its IUPAC name is ethane;(4E)-N,N,2,3,3-pentamethyl-4-[(Z)-prop-1-enyl]hepta-4,6-dien-1-amine.
| Compound Name | ethane;(4E)-N,N,2,3,3-pentamethyl-4-[(Z)-prop-1-enyl]hepta-4,6-dien-1-amine |
|---|---|
| PubChem CID | 143290460 |
| Molecular Formula | C17H33N |
| Molecular Weight | 251.46 g/mol |
| Exact Mass | 251.26 |
| IUPAC Name | ethane;(4E)-N,N,2,3,3-pentamethyl-4-[(Z)-prop-1-enyl]hepta-4,6-dien-1-amine |
| SMILES | C=C/C=C(\C=C/C)C(C)(C)C(C)CN(C)C.CC |
| InChI | InChI=1S/C15H27N.C2H6/c1-8-10-14(11-9-2)15(4,5)13(3)12-16(6)7;1-2/h8-11,13H,1,12H2,2-7H3;1-2H3/b11-9-,14-10+; |
| InChIKey | AMQWIAHIGGIBHV-HSFUHKPRSA-N |
| XLogP | 4.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|