C11H15N — CID 143290503
1-cyclohexa-1,5-dien-1-yl-3-azabicyclo[3.1.0]hexane (PubChem CID 143290503) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-3-azabicyclo[3.1.0]hexane.
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 143290503 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-3-azabicyclo[3.1.0]hexane |
| SMILES | C1=CC(C23CNCC2C3)=CCC1 |
| InChI | InChI=1S/C11H15N/c1-2-4-9(5-3-1)11-6-10(11)7-12-8-11/h2,4-5,10,12H,1,3,6-8H2 |
| InChIKey | GJGKQMSGXHNMOX-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |