C15H28N2O — CID 143290653
2-butyl-3-ethyl-1,3-diazaspiro[4.4]non-1-en-4-one;ethane (PubChem CID 143290653) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is 2-butyl-3-ethyl-1,3-diazaspiro[4.4]non-1-en-4-one;ethane.
| Compound Name | 2-butyl-3-ethyl-1,3-diazaspiro[4.4]non-1-en-4-one;ethane |
|---|---|
| PubChem CID | 143290653 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | 2-butyl-3-ethyl-1,3-diazaspiro[4.4]non-1-en-4-one;ethane |
| SMILES | CC.CCCCC1=NC2(CCCC2)C(=O)N1CC |
| InChI | InChI=1S/C13H22N2O.C2H6/c1-3-5-8-11-14-13(9-6-7-10-13)12(16)15(11)4-2;1-2/h3-10H2,1-2H3;1-2H3 |
| InChIKey | NFJFRWKCRAJNAD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |