C21H28FN3O — CID 143290696
(3R)-3-amino-4-(2-fluorophenyl)-1-[2-[2-[(Z)-prop-1-enyl]iminobut-3-enyl]pyrrolidin-1-yl]butan-1-one (PubChem CID 143290696) has the molecular formula C21H28FN3O and a molecular weight of 357.47 g/mol. Its IUPAC name is (3R)-3-amino-4-(2-fluorophenyl)-1-[2-[2-[(Z)-prop-1-enyl]iminobut-3-enyl]pyrrolidin-1-yl]butan-1-one.
| Compound Name | (3R)-3-amino-4-(2-fluorophenyl)-1-[2-[2-[(Z)-prop-1-enyl]iminobut-3-enyl]pyrrolidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 143290696 |
| Molecular Formula | C21H28FN3O |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | (3R)-3-amino-4-(2-fluorophenyl)-1-[2-[2-[(Z)-prop-1-enyl]iminobut-3-enyl]pyrrolidin-1-yl]butan-1-one |
| SMILES | C=C/C(CC1CCCN1C(=O)C[C@H](N)Cc1ccccc1F)=N\C=C/C |
| InChI | InChI=1S/C21H28FN3O/c1-3-11-24-18(4-2)15-19-9-7-12-25(19)21(26)14-17(23)13-16-8-5-6-10-20(16)22/h3-6,8,10-11,17,19H,2,7,9,12-15,23H2,1H3/b11-3-,24-18+/t17-,19?/m1/s1 |
| InChIKey | GJEBDXLHMUWJIU-ITHLWCMCSA-N |
| XLogP | 3.63 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|