C25H28N6O2 — CID 143294063
isoquinoline-3-carbaldehyde;2-(methylamino)-N-(piperidin-3-ylmethyl)-1H-benzimidazole-4-carboxamide (PubChem CID 143294063) has the molecular formula C25H28N6O2 and a molecular weight of 444.54 g/mol. Its IUPAC name is isoquinoline-3-carbaldehyde;2-(methylamino)-N-(piperidin-3-ylmethyl)-1H-benzimidazole-4-carboxamide.
| Compound Name | isoquinoline-3-carbaldehyde;2-(methylamino)-N-(piperidin-3-ylmethyl)-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 143294063 |
| Molecular Formula | C25H28N6O2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | isoquinoline-3-carbaldehyde;2-(methylamino)-N-(piperidin-3-ylmethyl)-1H-benzimidazole-4-carboxamide |
| SMILES | CNc1nc2c(C(=O)NCC3CCCNC3)cccc2[nH]1.O=Cc1cc2ccccc2cn1 |
| InChI | InChI=1S/C15H21N5O.C10H7NO/c1-16-15-19-12-6-2-5-11(13(12)20-15)14(21)18-9-10-4-3-7-17-8-10;12-7-10-5-8-3-1-2-4-9(8)6-11-10/h2,5-6,10,17H,3-4,7-9H2,1H3,(H,18,21)(H2,16,19,20);1-7H |
| InChIKey | MPNQBYQVZJSEOU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|