C36H59N7O5S — CID 143294618
N-(dimethylaminosulfanyl)-N'-[3-(propylamino)propyl]methanimidamide;2-oxoethyl 4-[2-(2-formamidophenyl)ethyl-methylamino]piperidine-1-carboxylate;2,4,6-trimethylphenol (PubChem CID 143294618) has the molecular formula C36H59N7O5S and a molecular weight of 701.98 g/mol. Its IUPAC name is N-(dimethylaminosulfanyl)-N'-[3-(propylamino)propyl]methanimidamide;2-oxoethyl 4-[2-(2-formamidophenyl)ethyl-methylamino]piperidine-1-carboxylate;2,4,6-trimethylphenol.
| Compound Name | N-(dimethylaminosulfanyl)-N'-[3-(propylamino)propyl]methanimidamide;2-oxoethyl 4-[2-(2-formamidophenyl)ethyl-methylamino]piperidine-1-carboxylate;2,4,6-trimethylphenol |
|---|---|
| PubChem CID | 143294618 |
| Molecular Formula | C36H59N7O5S |
| Molecular Weight | 701.98 g/mol |
| Exact Mass | 701.43 |
| IUPAC Name | N-(dimethylaminosulfanyl)-N'-[3-(propylamino)propyl]methanimidamide;2-oxoethyl 4-[2-(2-formamidophenyl)ethyl-methylamino]piperidine-1-carboxylate;2,4,6-trimethylphenol |
| SMILES | CCCNCCC/N=C/NSN(C)C.CN(CCc1ccccc1NC=O)C1CCN(C(=O)OCC=O)CC1.Cc1cc(C)c(O)c(C)c1 |
| InChI | InChI=1S/C18H25N3O4.C9H22N4S.C9H12O/c1-20(9-6-15-4-2-3-5-17(15)19-14-23)16-7-10-21(11-8-16)18(24)25-13-12-22;1-4-6-10-7-5-8-11-9-12-14-13(2)3;1-6-4-7(2)9(10)8(3)5-6/h2-5,12,14,16H,6-11,13H2,1H3,(H,19,23);9-10H,4-8H2,1-3H3,(H,11,12);4-5,10H,1-3H3 |
| InChIKey | TXMKSIZUJLZUEX-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 138.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.98 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|