C31H36N6O3 — CID 143791372
N-[2-[2-[[1-[6-(2-ethyl-1-methylindole-3-carbonyl)pyrimidin-4-yl]piperidin-4-yl]-methylamino]ethyl]-4-hydroxyphenyl]formamide (PubChem CID 143791372) has the molecular formula C31H36N6O3 and a molecular weight of 540.67 g/mol. Its IUPAC name is N-[2-[2-[[1-[6-(2-ethyl-1-methylindole-3-carbonyl)pyrimidin-4-yl]piperidin-4-yl]-methylamino]ethyl]-4-hydroxyphenyl]formamide.
| Compound Name | N-[2-[2-[[1-[6-(2-ethyl-1-methylindole-3-carbonyl)pyrimidin-4-yl]piperidin-4-yl]-methylamino]ethyl]-4-hydroxyphenyl]formamide |
|---|---|
| PubChem CID | 143791372 |
| Molecular Formula | C31H36N6O3 |
| Molecular Weight | 540.67 g/mol |
| Exact Mass | 540.28 |
| IUPAC Name | N-[2-[2-[[1-[6-(2-ethyl-1-methylindole-3-carbonyl)pyrimidin-4-yl]piperidin-4-yl]-methylamino]ethyl]-4-hydroxyphenyl]formamide |
| SMILES | CCc1c(C(=O)c2cc(N3CCC(N(C)CCc4cc(O)ccc4NC=O)CC3)ncn2)c2ccccc2n1C |
| InChI | InChI=1S/C31H36N6O3/c1-4-27-30(24-7-5-6-8-28(24)36(27)3)31(40)26-18-29(33-19-32-26)37-15-12-22(13-16-37)35(2)14-11-21-17-23(39)9-10-25(21)34-20-38/h5-10,17-20,22,39H,4,11-16H2,1-3H3,(H,34,38) |
| InChIKey | JLDXWIFZKXETOF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.67 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|