C39H28N4O8 — CID 143295327
[4-[2-[3,4-bis(pyridine-3-carbonyloxy)phenyl]propan-2-yl]-2-(pyridine-3-carbonyloxy)phenyl] pyridine-3-carboxylate (PubChem CID 143295327) has the molecular formula C39H28N4O8 and a molecular weight of 680.67 g/mol. Its IUPAC name is [4-[2-[3,4-bis(pyridine-3-carbonyloxy)phenyl]propan-2-yl]-2-(pyridine-3-carbonyloxy)phenyl] pyridine-3-carboxylate.
| Compound Name | [4-[2-[3,4-bis(pyridine-3-carbonyloxy)phenyl]propan-2-yl]-2-(pyridine-3-carbonyloxy)phenyl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 143295327 |
| Molecular Formula | C39H28N4O8 |
| Molecular Weight | 680.67 g/mol |
| Exact Mass | 680.19 |
| IUPAC Name | [4-[2-[3,4-bis(pyridine-3-carbonyloxy)phenyl]propan-2-yl]-2-(pyridine-3-carbonyloxy)phenyl] pyridine-3-carboxylate |
| SMILES | CC(C)(c1ccc(OC(=O)c2cccnc2)c(OC(=O)c2cccnc2)c1)c1ccc(OC(=O)c2cccnc2)c(OC(=O)c2cccnc2)c1 |
| InChI | InChI=1S/C39H28N4O8/c1-39(2,29-11-13-31(48-35(44)25-7-3-15-40-21-25)33(19-29)50-37(46)27-9-5-17-42-23-27)30-12-14-32(49-36(45)26-8-4-16-41-22-26)34(20-30)51-38(47)28-10-6-18-43-24-28/h3-24H,1-2H3 |
| InChIKey | SVRSPZORLXZGSZ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 156.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.67 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|