C34H50Cl2N2O2S — CID 143297153
(E)-1-(3,5-dichlorophenyl)sulfanyl-1-N-[(2E,3Z)-2-ethylidene-5-methoxyhexa-3,5-dienyl]-2-N,3-dimethyl-1-N-(2-phenylmethoxyethyl)but-1-ene-1,2-diamine;ethane (PubChem CID 143297153) has the molecular formula C34H50Cl2N2O2S and a molecular weight of 621.76 g/mol. Its IUPAC name is (E)-1-(3,5-dichlorophenyl)sulfanyl-1-N-[(2E,3Z)-2-ethylidene-5-methoxyhexa-3,5-dienyl]-2-N,3-dimethyl-1-N-(2-phenylmethoxyethyl)but-1-ene-1,2-diamine;ethane.
| Compound Name | (E)-1-(3,5-dichlorophenyl)sulfanyl-1-N-[(2E,3Z)-2-ethylidene-5-methoxyhexa-3,5-dienyl]-2-N,3-dimethyl-1-N-(2-phenylmethoxyethyl)but-1-ene-1,2-diamine;ethane |
|---|---|
| PubChem CID | 143297153 |
| Molecular Formula | C34H50Cl2N2O2S |
| Molecular Weight | 621.76 g/mol |
| Exact Mass | 620.30 |
| IUPAC Name | (E)-1-(3,5-dichlorophenyl)sulfanyl-1-N-[(2E,3Z)-2-ethylidene-5-methoxyhexa-3,5-dienyl]-2-N,3-dimethyl-1-N-(2-phenylmethoxyethyl)but-1-ene-1,2-diamine;ethane |
| SMILES | C=C(/C=C\C(=C/C)CN(CCOCc1ccccc1)/C(Sc1cc(Cl)cc(Cl)c1)=C(\NC)C(C)C)OC.CC.CC |
| InChI | InChI=1S/C30H38Cl2N2O2S.2C2H6/c1-7-24(14-13-23(4)35-6)20-34(15-16-36-21-25-11-9-8-10-12-25)30(29(33-5)22(2)3)37-28-18-26(31)17-27(32)19-28;2*1-2/h7-14,17-19,22,33H,4,15-16,20-21H2,1-3,5-6H3;2*1-2H3/b14-13-,24-7+,30-29+;; |
| InChIKey | SLVVTYLFKMOUPG-QXHZCOINSA-N |
| XLogP | 10.36 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.76 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|