C25H31Cl2NOS — CID 142824453
N-[(E)-2-(3,5-dichlorophenyl)sulfanyl-4-methylpent-2-en-3-yl]-3-methyl-1-phenylmethoxypentan-2-imine (PubChem CID 142824453) has the molecular formula C25H31Cl2NOS and a molecular weight of 464.50 g/mol. Its IUPAC name is N-[(E)-2-(3,5-dichlorophenyl)sulfanyl-4-methylpent-2-en-3-yl]-3-methyl-1-phenylmethoxypentan-2-imine.
| Compound Name | N-[(E)-2-(3,5-dichlorophenyl)sulfanyl-4-methylpent-2-en-3-yl]-3-methyl-1-phenylmethoxypentan-2-imine |
|---|---|
| PubChem CID | 142824453 |
| Molecular Formula | C25H31Cl2NOS |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | N-[(E)-2-(3,5-dichlorophenyl)sulfanyl-4-methylpent-2-en-3-yl]-3-methyl-1-phenylmethoxypentan-2-imine |
| SMILES | CCC(C)/C(COCc1ccccc1)=N/C(=C(\C)Sc1cc(Cl)cc(Cl)c1)C(C)C |
| InChI | InChI=1S/C25H31Cl2NOS/c1-6-18(4)24(16-29-15-20-10-8-7-9-11-20)28-25(17(2)3)19(5)30-23-13-21(26)12-22(27)14-23/h7-14,17-18H,6,15-16H2,1-5H3/b25-19+,28-24+ |
| InChIKey | KHVUXQHVTWFRQR-YDJZMOBPSA-N |
| XLogP | 8.68 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|