C31H46Cl2O2S — CID 142824277
1,3-dichloro-5-[(Z)-3,4-dimethylpent-2-en-2-yl]sulfanylbenzene;(E)-4-(phenylmethoxymethyl)hept-4-en-1-ol;propane (PubChem CID 142824277) has the molecular formula C31H46Cl2O2S and a molecular weight of 553.68 g/mol. Its IUPAC name is 1,3-dichloro-5-[(Z)-3,4-dimethylpent-2-en-2-yl]sulfanylbenzene;(E)-4-(phenylmethoxymethyl)hept-4-en-1-ol;propane.
| Compound Name | 1,3-dichloro-5-[(Z)-3,4-dimethylpent-2-en-2-yl]sulfanylbenzene;(E)-4-(phenylmethoxymethyl)hept-4-en-1-ol;propane |
|---|---|
| PubChem CID | 142824277 |
| Molecular Formula | C31H46Cl2O2S |
| Molecular Weight | 553.68 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | 1,3-dichloro-5-[(Z)-3,4-dimethylpent-2-en-2-yl]sulfanylbenzene;(E)-4-(phenylmethoxymethyl)hept-4-en-1-ol;propane |
| SMILES | C/C(Sc1cc(Cl)cc(Cl)c1)=C(\C)C(C)C.CC/C=C(\CCCO)COCc1ccccc1.CCC |
| InChI | InChI=1S/C15H22O2.C13H16Cl2S.C3H8/c1-2-7-14(10-6-11-16)12-17-13-15-8-4-3-5-9-15;1-8(2)9(3)10(4)16-13-6-11(14)5-12(15)7-13;1-3-2/h3-5,7-9,16H,2,6,10-13H2,1H3;5-8H,1-4H3;3H2,1-2H3/b14-7+;10-9-; |
| InChIKey | VKXMZXZUQVBTMK-FUKZTYGTSA-N |
| XLogP | 10.76 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.68 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|