C16H34N2O — CID 143297365
N,2-dimethylpropan-2-amine;5-pentylpiperidine-2-carbaldehyde (PubChem CID 143297365) has the molecular formula C16H34N2O and a molecular weight of 270.46 g/mol. Its IUPAC name is N,2-dimethylpropan-2-amine;5-pentylpiperidine-2-carbaldehyde.
| Compound Name | N,2-dimethylpropan-2-amine;5-pentylpiperidine-2-carbaldehyde |
|---|---|
| PubChem CID | 143297365 |
| Molecular Formula | C16H34N2O |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.27 |
| IUPAC Name | N,2-dimethylpropan-2-amine;5-pentylpiperidine-2-carbaldehyde |
| SMILES | CCCCCC1CCC(C=O)NC1.CNC(C)(C)C |
| InChI | InChI=1S/C11H21NO.C5H13N/c1-2-3-4-5-10-6-7-11(9-13)12-8-10;1-5(2,3)6-4/h9-12H,2-8H2,1H3;6H,1-4H3 |
| InChIKey | HARSZIOTQBPMEK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|