C10H11FN2OS — CID 143305266
4-[[2-(2-fluoroethynyl)-1,3-thiazol-5-yl]methyl]morpholine (PubChem CID 143305266) has the molecular formula C10H11FN2OS and a molecular weight of 226.28 g/mol. Its IUPAC name is 4-[[2-(2-fluoroethynyl)-1,3-thiazol-5-yl]methyl]morpholine.
| Compound Name | 4-[[2-(2-fluoroethynyl)-1,3-thiazol-5-yl]methyl]morpholine |
|---|---|
| PubChem CID | 143305266 |
| Molecular Formula | C10H11FN2OS |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 4-[[2-(2-fluoroethynyl)-1,3-thiazol-5-yl]methyl]morpholine |
| SMILES | FC#Cc1ncc(CN2CCOCC2)s1 |
| InChI | InChI=1S/C10H11FN2OS/c11-2-1-10-12-7-9(15-10)8-13-3-5-14-6-4-13/h7H,3-6,8H2 |
| InChIKey | SKAYLNRDNQRFFC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|