C26H33F3N4O2S2 — CID 143305836
(E)-2-[1-[(2E,4E)-2,4-difluorohexa-2,4-dienyl]-7-[(3-fluorophenyl)methyl]-6,7-dihydro-4H-thiopyrano[4,3-c]pyrazol-3-yl]-N'-pentylethenesulfonohydrazide (PubChem CID 143305836) has the molecular formula C26H33F3N4O2S2 and a molecular weight of 554.70 g/mol. Its IUPAC name is (E)-2-[1-[(2E,4E)-2,4-difluorohexa-2,4-dienyl]-7-[(3-fluorophenyl)methyl]-6,7-dihydro-4H-thiopyrano[4,3-c]pyrazol-3-yl]-N'-pentylethenesulfonohydrazide.
| Compound Name | (E)-2-[1-[(2E,4E)-2,4-difluorohexa-2,4-dienyl]-7-[(3-fluorophenyl)methyl]-6,7-dihydro-4H-thiopyrano[4,3-c]pyrazol-3-yl]-N'-pentylethenesulfonohydrazide |
|---|---|
| PubChem CID | 143305836 |
| Molecular Formula | C26H33F3N4O2S2 |
| Molecular Weight | 554.70 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | (E)-2-[1-[(2E,4E)-2,4-difluorohexa-2,4-dienyl]-7-[(3-fluorophenyl)methyl]-6,7-dihydro-4H-thiopyrano[4,3-c]pyrazol-3-yl]-N'-pentylethenesulfonohydrazide |
| SMILES | C/C=C(F)\C=C(\F)Cn1nc(/C=C/S(=O)(=O)NNCCCCC)c2c1C(Cc1cccc(F)c1)CSC2 |
| InChI | InChI=1S/C26H33F3N4O2S2/c1-3-5-6-11-30-32-37(34,35)12-10-25-24-18-36-17-20(13-19-8-7-9-22(28)14-19)26(24)33(31-25)16-23(29)15-21(27)4-2/h4,7-10,12,14-15,20,30,32H,3,5-6,11,13,16-18H2,1-2H3/b12-10+,21-4+,23-15+ |
| InChIKey | ZLIHKFWUMXFXJQ-KYBKVICLSA-N |
| XLogP | 5.91 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.70 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|