C17H19FN2O3S — CID 142694776
2-[(8R)-8-[(3-fluorophenyl)methyl]-1,4,5,6,7,8-hexahydrocyclohepta[c]pyrazol-3-yl]ethenesulfonic acid (PubChem CID 142694776) has the molecular formula C17H19FN2O3S and a molecular weight of 350.41 g/mol. Its IUPAC name is 2-[(8R)-8-[(3-fluorophenyl)methyl]-1,4,5,6,7,8-hexahydrocyclohepta[c]pyrazol-3-yl]ethenesulfonic acid.
| Compound Name | 2-[(8R)-8-[(3-fluorophenyl)methyl]-1,4,5,6,7,8-hexahydrocyclohepta[c]pyrazol-3-yl]ethenesulfonic acid |
|---|---|
| PubChem CID | 142694776 |
| Molecular Formula | C17H19FN2O3S |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 2-[(8R)-8-[(3-fluorophenyl)methyl]-1,4,5,6,7,8-hexahydrocyclohepta[c]pyrazol-3-yl]ethenesulfonic acid |
| SMILES | O=S(=O)(O)C=Cc1n[nH]c2c1CCCC[C@@H]2Cc1cccc(F)c1 |
| InChI | InChI=1S/C17H19FN2O3S/c18-14-6-3-4-12(11-14)10-13-5-1-2-7-15-16(19-20-17(13)15)8-9-24(21,22)23/h3-4,6,8-9,11,13H,1-2,5,7,10H2,(H,19,20)(H,21,22,23)/t13-/m1/s1 |
| InChIKey | ZQHBXHKCLMHKAH-CYBMUJFWSA-N |
| XLogP | 3.46 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|