C25H30ClN3O2 — CID 70827672
(9S)-9-[(3-chlorophenyl)methyl]-N-[(1R)-1-cyclohexa-2,4-dien-1-yl-2-hydroxyethyl]-4,5,6,7,8,9-hexahydro-1H-cycloocta[d]pyrazole-3-carboxamide (PubChem CID 70827672) has the molecular formula C25H30ClN3O2 and a molecular weight of 439.99 g/mol. Its IUPAC name is (9S)-9-[(3-chlorophenyl)methyl]-N-[(1R)-1-cyclohexa-2,4-dien-1-yl-2-hydroxyethyl]-4,5,6,7,8,9-hexahydro-1H-cycloocta[d]pyrazole-3-carboxamide.
| Compound Name | (9S)-9-[(3-chlorophenyl)methyl]-N-[(1R)-1-cyclohexa-2,4-dien-1-yl-2-hydroxyethyl]-4,5,6,7,8,9-hexahydro-1H-cycloocta[d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 70827672 |
| Molecular Formula | C25H30ClN3O2 |
| Molecular Weight | 439.99 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | (9S)-9-[(3-chlorophenyl)methyl]-N-[(1R)-1-cyclohexa-2,4-dien-1-yl-2-hydroxyethyl]-4,5,6,7,8,9-hexahydro-1H-cycloocta[d]pyrazole-3-carboxamide |
| SMILES | O=C(N[C@@H](CO)C1C=CC=CC1)c1n[nH]c2c1CCCCC[C@H]2Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C25H30ClN3O2/c26-20-12-7-8-17(15-20)14-19-11-5-2-6-13-21-23(19)28-29-24(21)25(31)27-22(16-30)18-9-3-1-4-10-18/h1,3-4,7-9,12,15,18-19,22,30H,2,5-6,10-11,13-14,16H2,(H,27,31)(H,28,29)/t18?,19-,22-/m0/s1 |
| InChIKey | KOEWJSCIPWQHRO-MLLWHUAMSA-N |
| XLogP | 4.73 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.99 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |