C24H26ClN3O2 — CID 58882537
8-[(3-chlorophenyl)methyl]-N-[(1R)-2-hydroxy-1-phenylethyl]-1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxamide (PubChem CID 58882537) has the molecular formula C24H26ClN3O2 and a molecular weight of 423.94 g/mol. Its IUPAC name is 8-[(3-chlorophenyl)methyl]-N-[(1R)-2-hydroxy-1-phenylethyl]-1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxamide.
| Compound Name | 8-[(3-chlorophenyl)methyl]-N-[(1R)-2-hydroxy-1-phenylethyl]-1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 58882537 |
| Molecular Formula | C24H26ClN3O2 |
| Molecular Weight | 423.94 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 8-[(3-chlorophenyl)methyl]-N-[(1R)-2-hydroxy-1-phenylethyl]-1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxamide |
| SMILES | O=C(N[C@@H](CO)c1ccccc1)c1n[nH]c2c1CCCCC2Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C24H26ClN3O2/c25-19-11-6-7-16(14-19)13-18-10-4-5-12-20-22(18)27-28-23(20)24(30)26-21(15-29)17-8-2-1-3-9-17/h1-3,6-9,11,14,18,21,29H,4-5,10,12-13,15H2,(H,26,30)(H,27,28)/t18?,21-/m0/s1 |
| InChIKey | XFJSCCHOOFTQRX-ZYZRXSCRSA-N |
| XLogP | 4.58 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.94 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |