C25H28ClN3O3 — CID 66647509
[8-[(3-chlorophenyl)methyl]-1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-yl] N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]carbamate (PubChem CID 66647509) has the molecular formula C25H28ClN3O3 and a molecular weight of 453.97 g/mol. Its IUPAC name is [8-[(3-chlorophenyl)methyl]-1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-yl] N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]carbamate.
| Compound Name | [8-[(3-chlorophenyl)methyl]-1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-yl] N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 66647509 |
| Molecular Formula | C25H28ClN3O3 |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | [8-[(3-chlorophenyl)methyl]-1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-yl] N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]carbamate |
| SMILES | O=C(N[C@H](CO)Cc1ccccc1)Oc1n[nH]c2c1CCCCC2Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C25H28ClN3O3/c26-20-11-6-9-18(14-20)13-19-10-4-5-12-22-23(19)28-29-24(22)32-25(31)27-21(16-30)15-17-7-2-1-3-8-17/h1-3,6-9,11,14,19,21,30H,4-5,10,12-13,15-16H2,(H,27,31)(H,28,29)/t19?,21-/m0/s1 |
| InChIKey | QVWYWTVKEQJMFY-QWAKEFERSA-N |
| XLogP | 4.81 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |