C24H28ClN3O — CID 71121642
(8R)-8-[(3-chlorophenyl)methyl]-N-[(1S)-1-cyclohexa-2,4-dien-1-ylethyl]-1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxamide (PubChem CID 71121642) has the molecular formula C24H28ClN3O and a molecular weight of 409.96 g/mol. Its IUPAC name is (8R)-8-[(3-chlorophenyl)methyl]-N-[(1S)-1-cyclohexa-2,4-dien-1-ylethyl]-1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxamide.
| Compound Name | (8R)-8-[(3-chlorophenyl)methyl]-N-[(1S)-1-cyclohexa-2,4-dien-1-ylethyl]-1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 71121642 |
| Molecular Formula | C24H28ClN3O |
| Molecular Weight | 409.96 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | (8R)-8-[(3-chlorophenyl)methyl]-N-[(1S)-1-cyclohexa-2,4-dien-1-ylethyl]-1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxamide |
| SMILES | C[C@H](NC(=O)c1n[nH]c2c1CCCC[C@@H]2Cc1cccc(Cl)c1)C1C=CC=CC1 |
| InChI | InChI=1S/C24H28ClN3O/c1-16(18-9-3-2-4-10-18)26-24(29)23-21-13-6-5-11-19(22(21)27-28-23)14-17-8-7-12-20(25)15-17/h2-4,7-9,12,15-16,18-19H,5-6,10-11,13-14H2,1H3,(H,26,29)(H,27,28)/t16-,18?,19+/m0/s1 |
| InChIKey | CBCLOWUUCNVPAK-DDPXNHEPSA-N |
| XLogP | 5.37 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.96 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |