C22H29ClN4O2S — CID 142701886
1-[8-[(3-chlorophenyl)methyl]-1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-yl]-N-piperidin-1-ylethenesulfonamide (PubChem CID 142701886) has the molecular formula C22H29ClN4O2S and a molecular weight of 449.02 g/mol. Its IUPAC name is 1-[8-[(3-chlorophenyl)methyl]-1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-yl]-N-piperidin-1-ylethenesulfonamide.
| Compound Name | 1-[8-[(3-chlorophenyl)methyl]-1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-yl]-N-piperidin-1-ylethenesulfonamide |
|---|---|
| PubChem CID | 142701886 |
| Molecular Formula | C22H29ClN4O2S |
| Molecular Weight | 449.02 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 1-[8-[(3-chlorophenyl)methyl]-1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-yl]-N-piperidin-1-ylethenesulfonamide |
| SMILES | C=C(c1n[nH]c2c1CCCCC2Cc1cccc(Cl)c1)S(=O)(=O)NN1CCCCC1 |
| InChI | InChI=1S/C22H29ClN4O2S/c1-16(30(28,29)26-27-12-5-2-6-13-27)21-20-11-4-3-9-18(22(20)25-24-21)14-17-8-7-10-19(23)15-17/h7-8,10,15,18,26H,1-6,9,11-14H2,(H,24,25) |
| InChIKey | SIKUZZCNYKRAOT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.02 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |