C24H21F2IN2O — CID 163796733
(E)-3-[1-(4-fluoro-2-iodophenyl)-8-[(3-fluorophenyl)methyl]-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrazol-3-yl]prop-2-enal (PubChem CID 163796733) has the molecular formula C24H21F2IN2O and a molecular weight of 518.35 g/mol. Its IUPAC name is (E)-3-[1-(4-fluoro-2-iodophenyl)-8-[(3-fluorophenyl)methyl]-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrazol-3-yl]prop-2-enal.
| Compound Name | (E)-3-[1-(4-fluoro-2-iodophenyl)-8-[(3-fluorophenyl)methyl]-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrazol-3-yl]prop-2-enal |
|---|---|
| PubChem CID | 163796733 |
| Molecular Formula | C24H21F2IN2O |
| Molecular Weight | 518.35 g/mol |
| Exact Mass | 518.07 |
| IUPAC Name | (E)-3-[1-(4-fluoro-2-iodophenyl)-8-[(3-fluorophenyl)methyl]-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrazol-3-yl]prop-2-enal |
| SMILES | O=C/C=C/c1nn(-c2ccc(F)cc2I)c2c1CCCCC2Cc1cccc(F)c1 |
| InChI | InChI=1S/C24H21F2IN2O/c25-18-7-3-5-16(14-18)13-17-6-1-2-8-20-22(9-4-12-30)28-29(24(17)20)23-11-10-19(26)15-21(23)27/h3-5,7,9-12,14-15,17H,1-2,6,8,13H2/b9-4+ |
| InChIKey | NBLJZBCSQUETQQ-RUDMXATFSA-N |
| XLogP | 6.02 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.35 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|