C32H34F3N3O3 — CID 58882502
ethyl (2R,3S)-3-[[1-(2,4-difluorophenyl)-8-[(4-fluorophenyl)methyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carbonyl]amino]bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 58882502) has the molecular formula C32H34F3N3O3 and a molecular weight of 565.64 g/mol. Its IUPAC name is ethyl (2R,3S)-3-[[1-(2,4-difluorophenyl)-8-[(4-fluorophenyl)methyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carbonyl]amino]bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | ethyl (2R,3S)-3-[[1-(2,4-difluorophenyl)-8-[(4-fluorophenyl)methyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carbonyl]amino]bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 58882502 |
| Molecular Formula | C32H34F3N3O3 |
| Molecular Weight | 565.64 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | ethyl (2R,3S)-3-[[1-(2,4-difluorophenyl)-8-[(4-fluorophenyl)methyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carbonyl]amino]bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C2CCC(C2)[C@@H]1NC(=O)c1nn(-c2ccc(F)cc2F)c2c1CCCCC2Cc1ccc(F)cc1 |
| InChI | InChI=1S/C32H34F3N3O3/c1-2-41-32(40)27-19-9-10-20(16-19)28(27)36-31(39)29-24-6-4-3-5-21(15-18-7-11-22(33)12-8-18)30(24)38(37-29)26-14-13-23(34)17-25(26)35/h7-8,11-14,17,19-21,27-28H,2-6,9-10,15-16H2,1H3,(H,36,39)/t19?,20?,21?,27-,28+/m1/s1 |
| InChIKey | MQAOILSZHBBTOI-GQXFROSMSA-N |
| XLogP | 6.05 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.64 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |